Pradimicin A

Pradimicin A (PRM-A) is a compound with potent antifungal capabilities, demonstrating a minimum inhibitory concentration (MIC) of 4 μg/mL against Candida rugosa. It also exhibits antiviral activity against viruses such as CoV, HIV, and other enveloped viruses. Additionally, Pradimicin A possesses the ability to aggregate and specifically recognize d-Man in the presence of Ca2+ ions [1] [2].

CN[C@H]1[C@@H](C)O[C@@H](O[C@@H]2[C@@H](O)c3cc4C(=O)c5c(O)cc(OC)cc5C(=O)c4c(O)c3-c3c(O)c(C(=O)N[C@H](C)C(O)=O)c(C)cc23)[C@H](O)[C@H]1O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O