Dazostinag disodium

Dazostinag disodium (TAK-676) is a synthetic novel interferon gene (STING) agonist that triggers STING signaling pathway activation and type I interferon activation. Dazostinag disodium (TAK-676) is also a highly effective immune system modulator with complete resolution and lasting memory of T cell immunity and the ability to promote lasting interferon-dependent anti-tumor immune responses.

O[C@H]1[C@@]2([C@@H](O[C@@]1(COP([S-])(O[C@@]3([C@@]([H])(COP([S-])(O2)=O)O[C@H]([C@@H]3F)N4C5=NC=NC(N)=C5N=C4)[H])=O)[H])N6C7=C(C(F)=C6)C(N=CN7)=O)[H].[Na+].[Na+]