Demeclocycline calcium

Demeclocycline calcium is a semisynthetic tetracycline antibiotic which was derived from a strain of Streptomyces aureofaciens. Demeclocycline binds to bacterial 30S ribosomal subunit and prevents binding of aminoacyl-tRNA to the mRNA-ribosome complex, thereby inhibiting protein synthesis. Demeclocycline also inhibits the effect of vasopressin on the renal tubules, thereby causing diuresis.

[Ca++].[H][C@]12C[C@@]3([H])[C@H](N(C)C)C([O-])=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@H]2O.[H][C@]12C[C@@]3([H])[C@H](N(C)C)C([O-])=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@H]2O