Antibiotic MA 144M2

Antibiotic MA 144M2 is an anthracycline glycoside that inhibits the growth of gram-positive bacteria, e.g. Staphyococcus aureaus, Bacillus subtilis and Sarcina lutea, and inhibits the growth of animal tumors such as leukemia L 1210, P 388 and sarcoma 180. It's produced by fermentation of MA 144-producing strains of streptomyces and by the chemical or enzymatic conversion of aclacinomycin A or cinerubin A.

C(OC)(=O)[C@@H]1C2=C([C@@H](O[C@H]3C[C@H](N(C)C)[C@H](O[C@H]4C[C@H](O)[C@H](O[C@@H]5O[C@@H](C)[C@H](O)CC5)[C@H](C)O4)[C@H](C)O3)C[C@@]1(CC)O)C(O)=C6C(=C2)C(=O)C=7C(C6=O)=C(O)C=CC7O