TL033

TL033 forms a component of an antibody-drug conjugate (ADC) as a drug-linker conjugate. It comprises a linker and a bioactive small molecule toxin. TL033 can be conjugated with the Sacituzumab antibody (anti-Trop-2) to synthesize BT001021, which exhibits anticancer activity against various cancers, including breast cancer, non-small cell lung cancer (NSCLC), and gastric cancer.

O=C1N2C(C=3C(C2)=C(CCN(S(C)(=O)=O)C(C)C)C=4C(N3)=CC=CC4)=CC5=C1COC(=O)[C@]5(OC(OCC6=CC=C(NC([C@@H](NC(COCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCN7C=C(CNC(CCCC#CC=8C=NC(S(C)(=O)=O)=NC8)=O)N=N7)=O)=O)CCCCN)=O)C=C6)=O)CC