PROTAC pan-KRAS degrader-1

PROTACpan-KRAS degrader-1 is a pan-KRAS PROTAC degrader that targets multiple KRAS mutants, including G12D, G12C, G12V, and G13D. It effectively degrades the KRAS mutant (G12D) in AGS cells, with a DC50 of 1.1 nM and a Dmax of 95%. This compound can be used in studies of diseases caused by KRAS mutations or amplifications, particularly in cancers such as breast, bladder, and gastric cancer.

C(C1(COC=2N=C(C3=C(N2)C(F)=C(N=C3)C=4C5=C(C=C(O)C4)C=CC(F)=C5CC)N6C[C@](C)(O)CCC6)CC1)N7CCC(OC=8C=NC(=CN8)C9=CN([C@H](C(=O)N%10[C@H](C(N[C@@H](C)C%11=CC=C(C=C%11)C%12=C(C)N=CS%12)=O)C[C@@H](O)C%10)C(C)C)N=N9)CC7