DF-006

DF-006 is an innovative orally active agonist of ALPK1 (α-kinase 1) . It stimulates the innate immune response in the liver by activating the NF-κB pathway. DF-006 effectively reduces serum levels of hepatitis B virus (HBV) DNA (EC50 = 2.7 pM), HBsAg, and HBeAg, demonstrating potent antiviral activity, making it suitable for immunotherapy research in chronic hepatitis B (CHB) .

O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](COP(OP(O[C@H]4[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]([C@H](COC(C)=O)F)(O4)[H])(=O)O)(=O)S)[C@H]1O