Trivalent GalNAc-DBCO

Trivalent GalNAc-DBCO is a synthetic ligand composed of three GalNAc units linked to DBCO. Trivalent GalNAc-DBCO undergoes strain-promoted alkyne–azide cycloaddition (SPAAC) reactions with azide-containing molecules without the need for copper catalysis. Trivalent GalNAc-DBCO binds specifically to the asialoglycoprotein receptor (ASGPR), thereby directing conjugated molecules into hepatocytes for lysosomal degradation through receptor-mediated endocytosis. Trivalent GalNAc-DBCO is extensively applied in studies of liver-targeted drug delivery, targeted degradation strategies, and hepatocyte-specific molecular engineering.

C(CCC(NCCOCCOCCOCCOCCC(NC(COCCC(NCCCNC(CCCCO[C@H]1[C@H](NC(C)=O)[C@@H](O)[C@@H](O)[C@@H](CO)O1)=O)=O)(COCCC(NCCCNC(CCCCO[C@H]2[C@H](NC(C)=O)[C@@H](O)[C@@H](O)[C@@H](CO)O2)=O)=O)COCCC(NCCCNC(CCCCO[C@H]3[C@H](NC(C)=O)[C@@H](O)[C@@H](O)[C@@H](CO)O3)=O)=O)=O)=O)(=O)N4C=5C(C#CC=6C(C4)=CC=CC6)=CC=CC5