ETN029

ETN029 is a ligand targeting DLL3. The 225Ac-labeled ETN029 exhibits dose-dependent cytotoxic effects on small cell lung cancer (SCLC), neuroendocrine prostate cancer (NEPC), and metastatic melanoma cells, and can induce H2AX phosphorylation. The 177Lu-labeled ETN029 has rapid tumor uptake, sustained retention, and a favorable tumor-to-renal distribution ratio. Therefore, ETN029 can be used for imaging and mechanism studies of tumors such as SCLC and NEPC.

C([C@@H](C(=O)N1[C@H](C(N)=O)CCC1)NC(=O)[C@H]2NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCCCNC(CN3CCN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC3)=O)NC(=O)[C@H](CC4=CC5=C(C=C4)C=CC=C5)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC6CCN(CC(O)=O)CC6)NC(=O)[C@@H](NC([C@@H](N(C([C@@H](NC([C@H](CC=7C=8C(NC7)=CC=CC8)NC(C)=O)=O)[C@@H](C)O)=O)C)CC(C)(C)C)=O)CSCSC2)C=9C=%10C(NC9)=CC=CC%10