Sulfo Cy5.5-N3

Sulfo Cy5.5-N3 is a fluorescent dye known as a Sulfo Cy5.5 azide. This compound can be employed in cell imaging via click chemistry. It contains an azide group, allowing it to participate in copper-catalyzed azide-alkyne cycloaddition reactions (CuAAC) with molecules containing alkyne groups. Additionally, it can engage in strain-promoted azide-alkyne cycloaddition reactions (SPAAC) with molecules that have DBCO or BCN groups.

CC1(C(=[N+](C2=C1C3=C(C=C2)C=C(C=C3)S(=O)(=O)[O-])CCCCCC(=O)NCCCN=[N+]=[N-])/C=C/C=C/C=C/4\C(C5=C(N4CCCCS(=O)(=O)O)C=CC6=C5C=CC(=C6)S(=O)(=O)[O-])(C)C)C.[Na+]