VZMC013

VZMC013 is a potent chemical probe targeting the MOR-CCR5 heterodimer, effectively inhibiting HIV-1 entry exacerbated by opioid compounds. It exhibits nanomolar binding affinity to both MOR and CCR5, inhibits CCL5-activated calcium mobilization, and significantly enhances anti-HIV-1BaL activity compared to previously reported bivalent ligands. In TZM-bl cells co-expressing CCR5 and MOR, VZMC013 demonstrates greater inhibition of viral infection than in cells expressing only CCR5. Additionally, VZMC013 blocks HIV-1 entry into peripheral blood mononuclear cells (PBMC) in a concentration-dependent manner and more effectively inhibits opioid-accelerated HIV-1 entry in phytohemagglutinin-activated PBMC than in opioid-free environments.

O=C(COCC(NCCCCCCCNC(COCC(NCCC1=NN=C(C(C)C)N1[C@H]2C[C@H]3N(CC[C@H](NC(C4CCC(F)(F)CC4)=O)C5=CC=CC=C5)[C@H](CC3)C2)=O)=O)=O)N[C@H](CC6)C7[C@]([C@]6(O)[C@H]8C9)(CCN8CC%10CC%10)C%11=C9C=CC(O)=C%11O7