Rhodopsin peptide

Rhodopsin peptide is a peptide with the sequence H2N-Val-Ser-Lys-Thr-Glu-Thr-Ser-Gln-Val-Ala-Pro-Ala-OH, MW= 1217.33. Rhodopsin is a biological pigment in photoreceptor cells of the retina that is responsible for the first events in the perception of light. Rhodopsins belong to the G-protein-coupled receptor family and are extremely sensitive to light. Mutation of the rhodopsin gene is a major contributor to various retinopathies such as retinitis pigmentosa.

CC(C)C(N)C(NC(CO)C(NC(CCCCN)C(NC(C(O)C)C(NC(CCC(O)=O)C(NC(C(O)C)C(NC(CO)C(NC(C(NC(C(C)C)C(NC(C)C(N1C(C(NC(C)C(O)=O)=O)CCC1)=O)=O)=O)CCC(N)=O)=O)=O)=O)=O)=O)=O)=O