What is the catalog number for [Glu1]-Fibrinopeptide B?

The catalog number for [Glu1]-Fibrinopeptide B is TP1864.

What sizes are available for [Glu1]-Fibrinopeptide B?

[Glu1]-Fibrinopeptide B is available in the following size(s): 1 mg, 5 mg.

How many pack sizes does [Glu1]-Fibrinopeptide B come in?

[Glu1]-Fibrinopeptide B is available in 2 different pack sizes.

Is [Glu1]-Fibrinopeptide B in stock?

[Glu1]-Fibrinopeptide B is currently made to order / not held in immediate stock. Contact us for lead time.

Who manufactures [Glu1]-Fibrinopeptide B?

[Glu1]-Fibrinopeptide B is manufactured by Molfinity.

What is the estimated delivery time for [Glu1]-Fibrinopeptide B?

Estimated delivery time for [Glu1]-Fibrinopeptide B is approximately 10 business day(s), depending on your location.

[Glu1]-Fibrinopeptide B

Product Specifications

CAS Number

103213-49-6

Bioactivity

[Glu1]-Fibrinopeptide B, a derivative of fibrinopeptide B amino acid residues 1-14, originates from human fibrinopeptide B (hFpB) . hFpB is a proteolytic cleavage product of the fibrinogen B beta-chain, specifically generated by thrombin, which plays a significant role in activating neutrophils (PMN), monocytes, and fibroblasts.

Smiles

[C@@H](CC1=CC=CC=C1)(NC([C@H](CC2=CC=CC=C2)NC(CNC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@H](CCC(O)=O)N)=O)=O)C(C)C)=O)CC(N)=O)=O)CC(O)=O)=O)CC(N)=O)=O)CCC(O)=O)=O)CCC(O)=O)=O)=O)=O)C(N[C@H](C(N[C@H](C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)C)=O)CO)=O