CLIP 86-100 acetate (648881-58-7 free base)

CLIP 86-100 acetate (648881-58-7 free base) is amino acids 86 to 100 fragment of class II-associated invariant chain peptide called CLIP. The major histocompatibility complex class II molecule displays peptide fragments of foreign proteins to trigger a defensive reaction from the immune system. Before insertion of the foreign peptides into the binding groove, a place-holding peptide CLIP is removed. CLIP 86-100 acetate (648881-58-7 free base) is accomplished by the molecule DM, which is shown to increase the dissociation rate of a CLIP peptide from class II.

C[C@@H](C(O)=O)NC([C@H](CCC(N)=O)NC([C@H](CCSC)NC([C@H](CC(C)C)NC([C@H](CC(C)C)NC([C@H]1N(C([C@H]([C@H](O)C)NC([C@H](C)NC([C@H](CCSC)NC([C@H](CCCNC(N)=N)NC([C@H](CCSC)NC([C@H](CCCCN)NC([C@H](CO)NC([C@H](C(C)C)NC([C@H]2NCCC2)=O)=O)=O)=O)=O)=O)=O)=O)=O)CCC1)=O)=O)=O)=O)=O.CC(O)=O