CLIP (86-100)

CLIP (86-100) is an amino acids 86 to 100 fragment of the class II-associated invariant chain peptide called CLIP. The major histocompatibility complex class II molecule displays peptide fragments of foreign proteins to trigger an immune response. Before foreign peptides bind, a place-holding CLIP peptide is removed by the molecule DM, which increases the dissociation rate of CLIP from class II.

C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(=O)[C@@H]1CCCN1)[C@@H](C)C)=O)CO)=O)CCCCN)=O)CCSC)=O)CCCNC(=N)N)=O)CCSC)=O)C)=O)[C@@H](C)O)(=O)N2[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)C)=O)CCC(N)=O)=O)CCSC)=O)CC(C)C)=O)CC(C)C)=O)CCC2