[Sar9, Met (O2) 11]-Substance P acetate

[Sar9, Met (O2) 11]-Substance P acetate is a tachykinin NK1 receptor selective agonist. [Sar9, Met (O2) 11]-Substance P acetate is a selective tachykinin NK1 receptor agonist.[Sar9, Met (O2) 11]-Substance P acetate and septide (10-100 pmol per rat, i.c.v.) are equipotent in increasing mean arterial blood pressure (MAP) and heart rate (HR), yet they have dissimilar time-course. Both agonists increase dose-dependently face washing and sniffing while [Sar9, Met (O2) 11]-Substance P acetate is the sole to produce grooming.

O=C(N1CCC[C@H]1C(N[C@H](C(N[C@@H](CCC(N)=O)C(N[C@H](C(N[C@@H](CC2=CC=CC=C2)C(N(CC(N[C@@H](CC(C)C)C(N[C@H](C(N)=O)CCS(C)(=O)=O)=O)=O)C)=O)=O)CC3=CC=CC=C3)=O)=O)CCC(N)=O)=O)[C@H](CCCCN)NC([C@H]4N(CCC4)C([C@H](CCCNC(N)=N)N)=O)=O.CC(O)=O.O