Bruceantinoside A

Bruceantinoside A is a naturally occurring quassinoid glucoside belonging to the triterpenoid glycoside class, isolated from the fruits of Brucea genus species including Brucea javanica and Brucea antidysenterica. Bruceantinoside A exhibits antileukemic and cytotoxic activities and is employed as a bioactive research compound in cancer biology. Its complex structure and bioactivity make it valuable for mechanistic studies of natural product-derived anticancer agents.

[H][C@]12[C@@H](OC(=O)\C=C(/C)C(C)C)C(=O)O[C@]3([H])C[C@@]4([H])[C@H](C)C(=O)C(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)=C[C@]4(C)[C@@]4([H])[C@@H](O)[C@H](O)[C@]1(OC[C@@]234)C(=O)OC