Onjisaponin Z

Onjisaponin Z is a natural product known as a triterpenoid saponin, characterized by its molecular structure that includes a sapogenin (aglycone) attached to one or more sugar moieties. Commonly found in the root of the medicinal herb Polygala tenuifolia, Onjisaponin Z exhibits a range of pharmacological effects, such as neuroprotective, anti-inflammatory, and antioxidant activities.

[H][C@@]1(O[C@H]2[C@H](C)O[C@@]([H])(O[C@H]3[C@H](OC(=O)[C@]45CCC(C)(C)C[C@@]4([H])C4=CC[C@]6([H])[C@@]7(C)C[C@H](O)[C@H](O[C@]8([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@](C)(C(O)=O)[C@]7([H])CC[C@@]6(C)[C@]4(CO)CC5)O[C@H](C)[C@H](OC(=O)\C=C\c4cc(OC)c(OC)c(OC)c4)[C@@H]3O[C@]3([H])O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@H](O)[C@@H]2O)OC[C@@H](O)[C@H](O)[C@H]1O