Geraniin

1. Geraniin has a protective effect against OVX-induced rat osteoporosis. 2. Geraniin has cytotoxic activity towards cancer cells in vitro and in vivo. 3. Geraniin exerts inhibitory effects on osteoclast differentiation in vitro and suppresses Ti particle-induced osteolysis in vivo, is a potential natural compound for the treatment of wear particle induced osteolysis in prostheses failure. 4. Geraniin has anti-oxidant activity, induces Nrf2-mediated expression of antioxidant enzymes HO-1 and NQO1, presumably via PI3K/AKT and ERK1/2 signaling pathways, thereby protecting cells from H2O2-induced oxidative cell death. 5. Geraniin presents radioprotective effects by regulating DNA damage on splenocytes, exerting immunostimulatory capacities and inhibiting apoptosis of radiosensitive immune cells and jejunal crypt cells.

Oc1cc(cc(O)c1O)C(=O)O[C@@H]1O[C@H]2COC(=O)c3cc(O)c(O)c(O)c3-c3c(O)c(O)c(O)cc3C(=O)O[C@@H]3[C@H]2OC(=O)C2=CC(=O)C4(O)Oc5c(O)c(O)cc(c5C2C4(O)O)C(=O)O[C@H]13