What is the catalog number for Monensin B?

The catalog number for Monensin B is T40383.

What sizes are available for Monensin B?

Monensin B is available in the following size(s): 25 mg.

Is Monensin B in stock?

Monensin B is currently made to order / not held in immediate stock. Contact us for lead time.

Who manufactures Monensin B?

Monensin B is manufactured by Molfinity.

What is the estimated delivery time for Monensin B?

Estimated delivery time for Monensin B is approximately 10 business day(s), depending on your location.

Monensin B

Product Specifications

CAS Number

30485-16-6

Target

Others

Related Pathways

Others

Bioactivity

Monensin B is a polyketide compound derived from the bacterium Streptomyces cinnamonensis. Its production involves the fermentation of Streptomyces cinnamonensis, resulting in a mixture of Monensin A and Monensin B. The ratio of these two compounds depends on the concentrations of ethylmalonyl-CoA and methylmalonyl-CoA.

Smiles

[H][C@@]1(C[C@H](C)[C@@]([H])(O1)[C@]1(C)CC[C@@]([H])(O1)[C@]1(C)CC[C@]2(C[C@H](O)[C@@H](C)[C@]([H])(O2)[C@@H](C)[C@@H](OC)[C@H](C)C(O)=O)O1)[C@@]1([H])O[C@@](O)(CO)[C@H](C)C[C@@H]1C