OM99-2 TFA

OM99-2 TFA is an eight-residue peptidomimetic compound, functioning as a tight-binding inhibitor of human brain memapsin 2. It exhibits a high affinity for the target with a Ki value of 9.58 nM, making it a promising candidate in the development of BACE1 inhibitors. Due to its potential, OM99-2 presents opportunities for further research in the field of Alzheimer's disease.

OC(=O)C(F)(F)F.CC(C)C[C@H](NC(=O)[C@@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CCC(O)=O)C(C)C)[C@@H](O)C[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](Cc1ccccc1)C(O)=O