Apelin-12

Apelin-12 is a highly potent C-terminal fragment of a polypeptide that exhibits a strong affinity towards the orphan receptor APJ. It plays a role in maintaining body fluid balance and regulating feeding control in the central nervous system. Additionally, Apelin-12 functions as an inhibitor of HIV-1 entry through the APJ receptor and demonstrates neuroprotective properties.

CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(O)=O