Okadaic acid ammonium salt

Okadaic acid ammonium salt is a marine toxin that acts as an inhibitor of protein phosphatases (PP), with the highest affinity for PP2A (IC50 = 0.1–0.3 nM), while also inhibiting PP1, PP3, PP4, and PP5, but not PP2C. By increasing the phosphorylation of various proteins, it functions as a tumor promoter and induces tau protein phosphorylation, commonly used to establish Alzheimer's disease models.

N.[H][C@]1(CC(C)=C[C@@]2(O[C@H](C[C@@](C)(O)C(O)=O)CC[C@H]2O)O1)[C@H](C)\C=C\[C@H]1CC[C@@]2(CC[C@@]3([H])O[C@]([H])([C@@H](O)C[C@H](C)[C@@]4([H])O[C@@]5(CCCCO5)CC[C@H]4C)C(=C)[C@@H](O)[C@]3([H])O2)O1|c:4|