CSP1

CSP1 is a highly potent and selective agonist of the ComD1 receptor, exhibiting an IC50 value of 10.3 nM. It represents a major variant of competence-stimulating peptide (CSP) and plays a crucial role in regulating the genetic transformation of S. pneumoniae through modulation of quorum sensing (QS) . Additionally, CSP1 possesses antibacterial activity, further enhancing its potential as an effective antibacterial agent.

CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCSC)NC(=O)[C@@H](N)CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(O)=O