MAGE-3 (271-279)

MAGE-3 (271-279) is a peptide consisting of 271-279 amino acid residues derived from melanoma antigens encoded by the MAGE-3 gene. It is specifically recognized by cytolytic T lymphocytes (CTLs) and binds to the human leukocyte antigen (HLA) -A2 molecule. MAGE-3 is highly expressed in various human tumor types, such as malignant melanoma, but not in normal tissues, except for the testis and placenta.

CC(C)C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(O)=O