Sordarin sodium

Sordarin is an inhibitor of fungal protein synthesis originally isolated from S. araneosa.[1] It binds to elongation factor 2 (EF-2) in the presence of ribosomes and inhibits the uncoupled GTPase activity of equimolar mixtures of EF-2 and ribosomes from C. albicans (IC50 = 0.1 ?M) . Sordarin inhibits protein synthesis in cell-free lysates of C. albicans, C. glabrata, and C. neoformans (IC50s = 0.01, 0.2, and 0.06 ?g/ml, respectively) but not in rabbit reticulocytes (IC50 = >100 ?g/ml) .[1] [2] It inhibits the growth of C. albicans (MIC = 8 ?g/ml) but not C. glabrata or C. neoformans (MICs = >125 ?g/ml) .

[Na].[H][C@]12C[C@]3(C=O)[C@]4([H])CC[C@@H](C)[C@@]4([H])C[C@@]1(CO[C@@H]1O[C@H](C)[C@@H](OC)[C@@H](O)[C@@H]1O)[C@]3(C(O)=O)C(=C2)C(C)C|c:37,TLB:7:4:16:35.34,15:16:3.4:35.34,THB:5:4:16:35.34,35:2:30:7.13.15|