Canagliflozin hemihydrate

Canagliflozin hemihydrate (TA 7284) is a drug of the gliflozin class or subtype 2 sodium-glucose transport inhibitors used for the treatment of type 2 diabetes. SGLT2 is responsible for at least 90% of renal glucose reabsorption (SGLT1 being responsible for the remaining 10%) . Blocking this transporter causes up to 119 grams of blood glucose per day to be eliminated through the urine, corresponding to 476 kilocalories.

O[C@H]1[C@H](C2=CC(CC3=CC=C(C4=CC=C(C=C4)F)S3)=C(C=C2)C)O[C@@H]([C@H]([C@@H]1O)O)CO.O[C@H]5[C@H](C6=CC(CC7=CC=C(C8=CC=C(C=C8)F)S7)=C(C=C6)C)O[C@@H]([C@H]([C@@H]5O)O)CO.O