XL-784

XL-784 is a selective inhibitor of matrix metalloproteinases (MMPs) with IC50 values of approximately 1900, 0.81, 120, 10.8, 18, and 0.56 nM for MMP-1, MMP-2, MMP-3, MMP-8, MMP-9, and MMP-13, respectively. XL-784 demonstrates potential in a broad range of cancer research applications due to its capability to modulate extracellular matrix remodeling, tumor invasion, and metastasis.

O=C(N1CCN(S(=O)(C2=CC(F)=C(C(F)=C2)OC3=CC=C(C=C3)Cl)=O)C(C1)C(N[O-])=O)OCCOC.O=C(N4CCN(S(=O)(C5=CC(F)=C(C(F)=C5)OC6=CC=C(C=C6)Cl)=O)C(C4)C(N[O-])=O)OCCOC.[Mg+2]