What is the catalog number for Polymyxin B Sulfate?

The catalog number for Polymyxin B Sulfate is T1100.

What sizes are available for Polymyxin B Sulfate?

Polymyxin B Sulfate is available in the following size(s): 500 mg, 1 g.

How many pack sizes does Polymyxin B Sulfate come in?

Polymyxin B Sulfate is available in 2 different pack sizes.

Is Polymyxin B Sulfate in stock?

Polymyxin B Sulfate is currently made to order / not held in immediate stock. Contact us for lead time.

Who manufactures Polymyxin B Sulfate?

Polymyxin B Sulfate is manufactured by Molfinity.

What is the estimated delivery time for Polymyxin B Sulfate?

Estimated delivery time for Polymyxin B Sulfate is approximately 10 business day(s), depending on your location.

Polymyxin B Sulfate

Product Specifications

CAS Number

1405-20-5

Target

Antibacterial, Antibiotic

Related Pathways

Microbiology/Virology

Purity

0.9996

Bioactivity

Polymyxin B Sulfate (Poly-RX) is a mixture of polymyxins B1 and B2, obtained from Bacillus polymyxa strains. They are basic polypeptides of about eight amino acids and have cationic detergent action on cell membranes. Polymyxin B Sulfate (Poly-RX) is used for infections with gram-negative organisms, but may be neurotoxic and nephrotoxic.

Smiles

OS(O)(=O)=O.CCC(C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@@H](NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC1=O)[C@@H](C)O