A20FMDV2 TFA

A20FMDV2, a peptide derived from the ?-helical RGD cell-interacting domain of the VP1 capsid protein of foot-and-mouth disease virus (FMDV) serotype O, targets and binds ?V?6 integrin. It effectively disrupts ?V?6 integrin-mediated cell adhesion in H357 tongue squamous cell carcinoma cells that exhibit human ?V?6, with an inhibitory concentration (IC50) of 1.2 µM. Additionally, when labeled with 111indium-DTPA, A20FMDV2 (20 MBq) specifically attaches to ?V?6 integrin in a breast cancer mouse xenograft model using MCF10CA1a cells, facilitating targeted radiation imaging analysis.

OC(C(F)(F)F)=O.O=C(N[C@H](C(N[C@@H](C(C)C)C(N1CCC[C@H]1C(N[C@@H](CC(N)=O)C(N[C@H](C(N[C@@H](CCCNC(N)=N)C(NCC(N[C@@H](CC(O)=O)C(N[C@H](C(N[C@@H](CCC(N)=O)C(N[C@@H](C(C)C)C(N[C@H](C(N[C@H](C(N[C@@H](CCC(N)=O)C(N[C@@H](CCCCN[H])C(N[C@@H](C(C)C)C(N[C@H](C(N[C@@H](CCCNC(N)=N)C(N[C@]([C@H](O)C)([H])C(O)=O)=O)=O)C)=O)=O)=O)=O)C)=O)CC(C)C)=O)=O)=O)CC(C)C)=O)=O)=O)=O)CC(C)C)=O)=O)=O)=O)C)[C@H](CC(N)=O)N[H]