ALB-109564 dihydrochloride

ALB-109564 dihydrochloride is a semi-synthetic derivative of the vinka alkaloid vinblastine with potential antineoplastic activity, a microtubule protein inhibitor and antineoplastic compound. It binds to tubulin monomers and inhibits microtubule formation, resulting in disruption of mitotic spindle assembly and arrest of tumor cells in the G2/M phase of the cell cycle.

CC[C@@]12[C@@]3([H])[C@]4(CCN3CC=C2)[C@](N(C5=CC(OC)=C([C@@]6(C7=C(CC[N@@]8C[C@](C[C@](O)(C8)CC)([H])C6)C9=CC(SC)=CC=C9N7)C(OC)=O)C=C54)C)([H])[C@](O)([C@@H]1OC(C)=O)C(OC)=O.Cl.Cl